indan-5-yl methyl ketone
5-Acetylindane
CAS: 4228-10-8
Molecular Formula: C11H12O
indan-5-yl methyl ketone - Names and Identifiers
| Name | 5-Acetylindane |
| Synonyms | Acetylindane 5-Acetylindan 5-ACETYLINDANE 5-Acetylindane BUTTPARK 95 4-40 indan-5-yl methyl ketone Ketone, 5-indanyl methyl 1-(2,3-dihydro-1H-inden-5-yl)ethanone 1-(2,3-dihydro-1H-inden-1-yl)ethanone 1-(2,3-Dihydro-1H-inden-5-yl)ethan-1-one 1-(2,3-DIHYDRO-1H-INDEN-5-YL)ETHAN-1-ONE 1-(2,3-DIHYDRO-1H-INDEN-5-YL)-1-ETHANONE |
| CAS | 4228-10-8 |
| InChI | InChI=1/C11H12O/c1-8(12)10-6-5-9-3-2-4-11(9)7-10/h5-7H,2-4H2,1H3 |
indan-5-yl methyl ketone - Physico-chemical Properties
| Molecular Formula | C11H12O |
| Molar Mass | 160.21 |
| Density | 1.067±0.06 g/cm3(Predicted) |
| Boling Point | 80 °C |
| Flash Point | 85-87°C/0.05mm |
| Vapor Presure | 0.00196mmHg at 25°C |
| Maximum wavelength(λmax) | 258nm(EtOH)(lit.) |
| Storage Condition | Room Temprature |
| Refractive Index | 1.5600-1.5640 |
| MDL | MFCD00021246 |
indan-5-yl methyl ketone - Risk and Safety
| Risk Codes | 22 - Harmful if swallowed |
| Safety Description | S24/25 - Avoid contact with skin and eyes. |
indan-5-yl methyl ketone - Introduction
5-Acetyllindane is an organic compound with the chemical formula C12H12O. The following is a description of its nature, use, preparation and safety information:
Nature:
1. Appearance: 5-Acetylindane is a colorless to pale yellow liquid.
2. density: 1.08 g/cm
3. melting point: 15-16 ℃
4. Boiling point: 286-292 ℃
5. Flammability: 5-Acetylindane is a flammable liquid and should avoid contact with fire sources.
Use:
5-Acetylindane is commonly used as an intermediate in organic synthesis and has some important applications:
1. pharmaceutical field: as a drug synthesis intermediates, such as the synthesis of some anticancer drugs.
2. cosmetics field: can be used for synthetic flavor and fragrance additives.
3. Organic synthesis field: can be used to synthesize a variety of organic compounds, such as synthetic dyes, plant extracts and other drugs.
Preparation Method:
The preparation method of 5-Acetylindane usually involves the following steps:
1. First, indane reacts with sodium hydroxide to form indane sodium salt.
2. The indane sodium salt is then reacted with acetic anhydride to produce 5-Acetyllindane.
Safety Information:
1. 5-Acetylindane is a flammable liquid and should be stored in a closed container, away from fire sources, heat sources and oxidants.
2. use should wear protective glasses and gloves, and ensure that the operating place is well ventilated.
3. Avoid contact with skin, eyes and respiratory tract. If exposed, rinse immediately with plenty of water and seek medical help.
4. Store and dispose of the compound properly and comply with local environmental regulations.
Nature:
1. Appearance: 5-Acetylindane is a colorless to pale yellow liquid.
2. density: 1.08 g/cm
3. melting point: 15-16 ℃
4. Boiling point: 286-292 ℃
5. Flammability: 5-Acetylindane is a flammable liquid and should avoid contact with fire sources.
Use:
5-Acetylindane is commonly used as an intermediate in organic synthesis and has some important applications:
1. pharmaceutical field: as a drug synthesis intermediates, such as the synthesis of some anticancer drugs.
2. cosmetics field: can be used for synthetic flavor and fragrance additives.
3. Organic synthesis field: can be used to synthesize a variety of organic compounds, such as synthetic dyes, plant extracts and other drugs.
Preparation Method:
The preparation method of 5-Acetylindane usually involves the following steps:
1. First, indane reacts with sodium hydroxide to form indane sodium salt.
2. The indane sodium salt is then reacted with acetic anhydride to produce 5-Acetyllindane.
Safety Information:
1. 5-Acetylindane is a flammable liquid and should be stored in a closed container, away from fire sources, heat sources and oxidants.
2. use should wear protective glasses and gloves, and ensure that the operating place is well ventilated.
3. Avoid contact with skin, eyes and respiratory tract. If exposed, rinse immediately with plenty of water and seek medical help.
4. Store and dispose of the compound properly and comply with local environmental regulations.
Last Update：2024-04-09 21:01:54
Supplier List
Product Name: 5-Acetylindane Visit Supplier Webpage Request for quotation
CAS: 4228-10-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 4228-10-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 5-Acetylindane Visit Supplier Webpage Request for quotation
CAS: 4228-10-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 4228-10-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History